CAS 850991-53-6
:ethyl (1S,5R)-6-oxo-3-azabicyclo[3.2.1]octane-3-carboxylate
Description:
Ethyl (1S,5R)-6-oxo-3-azabicyclo[3.2.1]octane-3-carboxylate is a bicyclic compound characterized by its unique structural framework, which includes a nitrogen atom within a bicyclic system. The presence of the oxo group (C=O) at the 6-position contributes to its reactivity and potential applications in organic synthesis. The ethyl ester functional group indicates that it can undergo hydrolysis to yield the corresponding carboxylic acid, making it versatile in various chemical reactions. The specific stereochemistry, denoted by the (1S,5R) configuration, suggests that the compound has distinct spatial arrangements that can influence its biological activity and interactions with other molecules. This compound may be of interest in medicinal chemistry due to its structural features, which could be relevant for drug design or as a potential pharmacophore. Overall, its unique bicyclic structure, functional groups, and stereochemistry contribute to its chemical properties and potential applications in research and industry.
Formula:C10H15NO3
InChI:InChI=1/C10H15NO3/c1-2-14-10(13)11-5-7-3-8(6-11)9(12)4-7/h7-8H,2-6H2,1H3/t7-,8+/m0/s1
Synonyms:- Ethyl (1S,5R)-6-oxo-3-azabicyclo[3.2.1]octane-3-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.