CAS 850996-85-9
:L-Ornithine, N2-[(1,1-dimethylethoxy)carbonyl]-N5-[(phenylmethoxy)carbonyl]-4-[[tris(1-methylethyl)silyl]oxy]-, (4S)-
Description:
L-Ornithine, N2-[(1,1-dimethylethoxy)carbonyl]-N5-[(phenylmethoxy)carbonyl]-4-[[tris(1-methylethyl)silyl]oxy]-, with the CAS number 850996-85-9, is a complex organic compound characterized by its multiple functional groups and protective moieties. This substance is a derivative of the amino acid ornithine, which plays a crucial role in the urea cycle and is involved in various metabolic processes. The presence of the dimethylethoxycarbonyl and phenylmethoxycarbonyl groups indicates that the compound is likely designed for specific reactivity or stability, often utilized in peptide synthesis or as a building block in organic chemistry. The tris(1-methylethyl)silyl group suggests enhanced stability and solubility, making it suitable for various applications in synthetic chemistry. Overall, this compound exemplifies the complexity and versatility of amino acid derivatives in chemical synthesis, particularly in the context of drug development and biochemistry.
Formula:C27H46N2O7Si
InChI:InChI=1S/C27H46N2O7Si/c1-18(2)37(19(3)4,20(5)6)36-22(15-23(24(30)31)29-26(33)35-27(7,8)9)16-28-25(32)34-17-21-13-11-10-12-14-21/h10-14,18-20,22-23H,15-17H2,1-9H3,(H,28,32)(H,29,33)(H,30,31)/t22-,23-/m0/s1
InChI key:InChIKey=QZLBJPHMNRGKEP-GOTSBHOMSA-N
SMILES:[Si](O[C@@H](C[C@H](NC(OC(C)(C)C)=O)C(O)=O)CNC(OCC1=CC=CC=C1)=O)(C(C)C)(C(C)C)C(C)C
Synonyms:- L-Ornithine, N2-[(1,1-dimethylethoxy)carbonyl]-N5-[(phenylmethoxy)carbonyl]-4-[[tris(1-methylethyl)silyl]oxy]-, (4S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.