
CAS 85100-78-3
:1-Hexyl-3-methylimidazolium bromide
Description:
1-Hexyl-3-methylimidazolium bromide is an ionic liquid belonging to the class of imidazolium-based salts. It features a long hydrophobic hexyl chain and a methyl group on the imidazole ring, contributing to its unique properties. This compound is typically characterized by its low volatility, high thermal stability, and excellent solvation capabilities, making it suitable for various applications, including as a solvent in chemical reactions and as an electrolyte in electrochemical devices. Its ionic nature imparts a relatively high viscosity compared to conventional solvents, while its ability to dissolve a wide range of organic and inorganic compounds enhances its utility in diverse fields such as catalysis, extraction processes, and materials science. Additionally, 1-Hexyl-3-methylimidazolium bromide exhibits good ionic conductivity, which is advantageous for applications in batteries and fuel cells. The bromide anion contributes to its solubility and stability, although the specific interactions and behavior can vary depending on the presence of other substances or conditions in the environment.
Formula:C10H19BrN2
InChI:InChI=1/C10H19N2.BrH/c1-3-4-5-6-7-12-9-8-11(2)10-12;/h8-10H,3-7H2,1-2H3;1H/q+1;/p-1
Synonyms:- 1-hexyl-3-methyl-1H-imidazol-3-ium bromide
- 1-Hexyl-3-Methylimidazolium Brimide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Hexyl-3-methylimidazolium bromide
CAS:Formula:C10H19BrN2Purity:98%Color and Shape:LiquidMolecular weight:247.17531-Hexyl-3-Methylimidazolium Bromide
CAS:1-Hexyl-3-Methylimidazolium BromidePurity:99%Molecular weight:247.18g/mol1-Hexyl-3-methylimidazolium Bromide
CAS:Formula:C10H19BrN2Purity:>98.0%(T)(HPLC)Color and Shape:Colorless to Red to Green clear liquid to slightly cloudy liquidMolecular weight:247.18



