
CAS 85103-02-2
:1-[(4-Nitrophenyl)methyl]-1H-imidazole-5-carboxaldehyde
Description:
1-[(4-Nitrophenyl)methyl]-1H-imidazole-5-carboxaldehyde is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a 4-nitrophenyl group indicates that there is a nitro substituent on the phenyl ring, contributing to the compound's potential reactivity and polarity. The aldehyde functional group at the 5-position of the imidazole ring is significant for its reactivity, particularly in condensation reactions and as a potential electrophile. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility properties can vary based on the solvent used, and it may display distinct UV-Vis absorption characteristics due to the presence of the nitro group. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 1-[(4-Nitrophenyl)methyl]-1H-imidazole-5-carboxaldehyde is a versatile compound with potential applications in various fields, including organic synthesis and pharmaceuticals.
Formula:C11H9N3O3
InChI:InChI=1S/C11H9N3O3/c15-7-11-5-12-8-13(11)6-9-1-3-10(4-2-9)14(16)17/h1-5,7-8H,6H2
InChI key:InChIKey=XPSKUOKYICJVPJ-UHFFFAOYSA-N
SMILES:C(N1C(C=O)=CN=C1)C2=CC=C(N(=O)=O)C=C2
Synonyms:- 1-(4-Nitrobenzyl)-5-imidazolecarboxaldehyde
- 1-[(4-Nitrophenyl)methyl]-1H-imidazole-5-carboxaldehyde
- 1H-Imidazole-5-carboxaldehyde, 1-[(4-nitrophenyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.