CAS 85105-75-5
:3,4-Thiophenediamine, tetrahydro-, 1,1-dioxide
Description:
3,4-Thiophenediamine, tetrahydro-, 1,1-dioxide, with the CAS number 85105-75-5, is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. This compound features two amine groups (-NH2) and a sulfone group (-SO2-) that contribute to its reactivity and potential applications in various chemical processes. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the amine groups. The compound is of interest in the fields of organic synthesis and materials science, particularly for its potential use in the development of dyes, pharmaceuticals, and polymers. Its unique electronic properties, derived from the thiophene moiety, may also lend it utility in electronic applications. Safety data should be consulted for handling and storage, as compounds with amine functionalities can be hazardous. Overall, 3,4-Thiophenediamine, tetrahydro-, 1,1-dioxide is a versatile compound with significant implications in various chemical domains.
Formula:C4H10N2O2S
InChI:InChI=1S/C4H10N2O2S/c5-3-1-9(7,8)2-4(3)6/h3-4H,1-2,5-6H2
InChI key:InChIKey=SHSRKYMXSFBHOU-UHFFFAOYSA-N
SMILES:O=S1(=O)CC(N)C(N)C1
Synonyms:- 3,4-Thiophenediamine, tetrahydro-, 1,1-dioxide
- 1,1-Dioxo-tetrahydro-1λ*6*-thiophene-3,4-diamine
- 1,1-Dioxothiolane-3,4-diamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.