CAS 851102-40-4

N-(6-methoxypyridin-2-yl)-2,2-dimethylpropanamide

Description:

N-(6-methoxypyridin-2-yl)-2,2-dimethylpropanamide, with the CAS number 851102-40-4, is a chemical compound characterized by its unique structural features. It contains a pyridine ring substituted with a methoxy group at the 6-position, which contributes to its potential biological activity. The amide functional group is linked to a branched alkyl chain, specifically 2,2-dimethylpropanamide, enhancing its lipophilicity and possibly influencing its pharmacokinetic properties. This compound may exhibit various properties such as solubility in organic solvents, moderate stability under standard conditions, and potential interactions with biological targets due to its heterocyclic structure. Its specific applications and biological activities would depend on further empirical studies, but compounds of this nature are often explored in medicinal chemistry for their potential therapeutic effects. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding toxicity and environmental impact.

Formula: C₁₁H₁₆N₂O₂

InChI: InChI=1/C11H16N2O2/c1-11(2,3)10(14)13-8-6-5-7-9(12-8)15-4/h5-7H,1-4H3,(H,12,13,14)

SMILES: CC(C)(C)C(=Nc1cccc(n1)OC)O

N-(6-METHOXY-PYRIDIN-2-YL)-2,2-DIMETHYLPROPIONAMIDE

CAS: 851102-40-4

Formula: C₁₁H₁₆N₂O₂

Color and Shape: Solid

Molecular weight: 208.2569

Ref: IN-DA003SDW