CymitQuimica logo

CAS 851102-43-7

:

6-iodopyridine-2-carbohydrazide

Description:
6-Iodopyridine-2-carbohydrazide is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with an iodine atom and a carbohydrazide functional group. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry and as a building block in organic synthesis. The presence of the iodine atom can enhance its reactivity and influence its biological activity, making it of interest in drug development. The carbohydrazide moiety contributes to its ability to form hydrogen bonds, which can be crucial for interactions with biological targets. Additionally, this compound may exhibit properties such as solubility in various organic solvents, depending on the specific conditions. Its synthesis often involves the reaction of appropriate precursors under controlled conditions, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and elemental analysis to confirm its structure and purity. Overall, 6-iodopyridine-2-carbohydrazide represents a versatile compound in the field of organic and medicinal chemistry.
Formula:C6H6IN3O
InChI:InChI=1/C6H6IN3O/c7-5-3-1-2-4(9-5)6(11)10-8/h1-3H,8H2,(H,10,11)
SMILES:c1cc(C(=O)NN)nc(c1)I
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.