CAS 851102-44-8
:N-(6-Iodo-2-pyridinyl)-2,2-dimethylpropanamide
Description:
N-(6-Iodo-2-pyridinyl)-2,2-dimethylpropanamide is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with an iodine atom and an amide functional group. The presence of the 6-iodo substituent on the pyridine ring enhances its reactivity and potential biological activity, making it of interest in medicinal chemistry. The 2,2-dimethylpropanamide portion contributes to the compound's steric bulk and may influence its interaction with biological targets. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in drug development, particularly in the design of compounds targeting specific receptors or enzymes. Additionally, the iodine atom can serve as a useful handle for further chemical modifications or for imaging purposes in biological studies. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C10H13IN2O
InChI:InChI=1S/C10H13IN2O/c1-10(2,3)9(14)13-8-6-4-5-7(11)12-8/h4-6H,1-3H3,(H,12,13,14)
InChI key:InChIKey=IQGOXDICYLCUCO-UHFFFAOYSA-N
SMILES:N(C(C(C)(C)C)=O)C=1N=C(I)C=CC1
Synonyms:- Propanamide, N-(6-iodo-2-pyridinyl)-2,2-dimethyl-
- N-(6-Iodo-2-pyridinyl)-2,2-dimethylpropanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
