CAS 851116-09-1

2,5,7-Trimethylpyrazolo[1,5-a]pyrimidine-6-propanoic acid

Description:

2,5,7-Trimethylpyrazolo[1,5-a]pyrimidine-6-propanoic acid is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrazole and pyrimidine rings. This compound features three methyl groups at the 2, 5, and 7 positions of the pyrazolo ring, contributing to its hydrophobic characteristics and potentially influencing its biological activity. The presence of a propanoic acid moiety at the 6-position enhances its solubility in polar solvents and may facilitate interactions with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential pharmacological properties, which may include anti-inflammatory or neuroprotective effects. Its molecular structure allows for various interactions with enzymes or receptors, making it a candidate for further research in drug development. As with many organic compounds, its stability, reactivity, and biological activity can be influenced by environmental factors such as pH and temperature. Proper handling and storage conditions are essential to maintain its integrity for research and application purposes.

Formula: C₁₂H₁₅N₃O₂

InChI: InChI=1S/C12H15N3O2/c1-7-6-11-13-8(2)10(4-5-12(16)17)9(3)15(11)14-7/h6H,4-5H2,1-3H3,(H,16,17)

InChI key: InChIKey=AHYIJUKMQAHZNZ-UHFFFAOYSA-N

SMILES: CC=1N2C(N=C(C)C1CCC(O)=O)=CC(C)=N2

Synonyms:

• 2,5,7-Trimethylpyrazolo[1,5-a]pyrimidine-6-propanoic acid
• Pyrazolo[1,5-a]pyrimidine-6-propanoic acid, 2,5,7-trimethyl-

3-(2,5,7-Trimethylpyrazolo[1,5-a]pyrimidin-6-yl)propanoic acid

CAS: 851116-09-1

Formula: C₁₂H₁₅N₃O₂

Molecular weight: 233.2664

Ref: IN-DA008GJ0

3-(2,5,7-Trimethyl-pyrazolo[1,5-a]pyrimidin-6-yl)-propionic acid

CAS: 851116-09-1

Versatile small molecule scaffold

Formula: C₁₂H₁₅N₃O₂

Purity: Min. 95%

Molecular weight: 233.27 g/mol

Ref: 3D-BJB11609