CAS 851116-22-8

2,3-Dihydro-2-methyl-1-(methylsulfonyl)-1H-indole-5-carboxylic acid

Description:

2,3-Dihydro-2-methyl-1-(methylsulfonyl)-1H-indole-5-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a methylsulfonyl group, which contributes to its solubility and reactivity, and a carboxylic acid functional group that can participate in various chemical reactions, including esterification and acid-base reactions. The presence of the methyl group enhances its lipophilicity, potentially influencing its biological activity. The compound is likely to exhibit moderate stability under standard conditions but may be sensitive to extreme pH or temperature variations. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. As with many indole derivatives, it may exhibit interesting pharmacological properties, including anti-inflammatory or analgesic effects, although specific biological activities would require further investigation. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₁H₁₃NO₄S

InChI: InChI=1S/C11H13NO4S/c1-7-5-9-6-8(11(13)14)3-4-10(9)12(7)17(2,15)16/h3-4,6-7H,5H2,1-2H3,(H,13,14)

InChI key: InChIKey=CACJWHAAEBJJHE-UHFFFAOYSA-N

SMILES: S(C)(=O)(=O)N1C=2C(CC1C)=CC(C(O)=O)=CC2

Synonyms:

• 1H-Indole-5-carboxylic acid, 2,3-dihydro-2-methyl-1-(methylsulfonyl)-
• 2,3-Dihydro-2-methyl-1-(methylsulfonyl)-1H-indole-5-carboxylic acid

1-Methanesulfonyl-2-methyl-2,3-dihydro-1H-indole-5-carboxylic acid

CAS: 851116-22-8

Versatile small molecule scaffold

Formula: C₁₁H₁₃NO₄S

Purity: Min. 95%

Molecular weight: 255.29 g/mol

Ref: 3D-BJB11622