CAS 851116-65-9

N-[(4-Cyanophenyl)sulfonyl]glycylglycine

Description:

N-[(4-Cyanophenyl)sulfonyl]glycylglycine, identified by its CAS number 851116-65-9, is a synthetic compound that features a glycine backbone modified with a sulfonyl group and a cyanophenyl substituent. This compound is characterized by its sulfonamide functional group, which typically enhances solubility and can influence biological activity. The presence of the cyanophenyl moiety may impart specific electronic properties and steric effects, potentially affecting its interactions in biological systems. The compound is likely to exhibit polar characteristics due to the sulfonyl and amino groups, which can facilitate hydrogen bonding. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, the compound's stability, reactivity, and solubility can be influenced by environmental factors such as pH and temperature. As with many synthetic compounds, safety and handling precautions should be observed, particularly in laboratory settings, to mitigate any potential hazards associated with its use.

Formula: C₁₁H₁₁N₃O₅S

InChI: InChI=1S/C11H11N3O5S/c12-5-8-1-3-9(4-2-8)20(18,19)14-6-10(15)13-7-11(16)17/h1-4,14H,6-7H2,(H,13,15)(H,16,17)

InChI key: InChIKey=PDGJPCHJZAPZQH-UHFFFAOYSA-N

SMILES: S(NCC(NCC(O)=O)=O)(=O)(=O)C1=CC=C(C#N)C=C1

Synonyms:

• Glycine, N-[(4-cyanophenyl)sulfonyl]glycyl-
• 2-[[2-[(4-Cyanophenyl)sulfonylamino]acetyl]amino]acetic acid
• 2-[2-(4-Cyanobenzenesulfonamido)acetamido]acetic acid
• N-[(4-Cyanophenyl)sulfonyl]glycylglycine
• [({[(4-Cyanophenyl)sulfonyl]amino}acetyl)amino]acetic acid