CAS 851169-19-2

2,3,6,7-Tetrahydro-2,6-dioxo-3,7-bis(phenylmethyl)-1H-purine-1-acetic acid hydrazide

Description:

2,3,6,7-Tetrahydro-2,6-dioxo-3,7-bis(phenylmethyl)-1H-purine-1-acetic acid hydrazide is a synthetic compound that belongs to the purine class of molecules. It features a complex structure characterized by a purine core with multiple functional groups, including hydrazide and acetic acid moieties. The presence of phenylmethyl groups contributes to its hydrophobic characteristics, potentially influencing its solubility and biological activity. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its unique structural features suggest potential interactions with biological targets, which could be explored for therapeutic applications. However, specific data regarding its biological activity, toxicity, and pharmacokinetics would require further investigation through empirical studies. As with many synthetic compounds, safety and handling precautions should be observed, and its use should comply with relevant regulations.

Formula: C₂₁H₂₀N₆O₃

InChI: InChI=1S/C21H20N6O3/c22-24-17(28)13-27-20(29)18-19(23-14-25(18)11-15-7-3-1-4-8-15)26(21(27)30)12-16-9-5-2-6-10-16/h1-10,14H,11-13,22H2,(H,24,28)

InChI key: InChIKey=MAPBKOSPOHFVRU-UHFFFAOYSA-N

SMILES: C(N1C2=C(N(CC3=CC=CC=C3)C=N2)C(=O)N(CC(NN)=O)C1=O)C4=CC=CC=C4

Synonyms:

• 2,3,6,7-Tetrahydro-2,6-dioxo-3,7-bis(phenylmethyl)-1H-purine-1-acetic acid hydrazide
• 1H-Purine-1-acetic acid, 2,3,6,7-tetrahydro-2,6-dioxo-3,7-bis(phenylmethyl)-, hydrazide