CAS 851169-40-9

2-Chloro-N-[1-(4-fluorophenyl)ethyl]acetamide

Description:

2-Chloro-N-[1-(4-fluorophenyl)ethyl]acetamide is a chemical compound characterized by its unique structure, which includes a chloro group, an acetamide functional group, and a substituted ethyl group with a para-fluorophenyl moiety. This compound typically appears as a solid or crystalline substance and is soluble in organic solvents, reflecting its polar nature due to the presence of the acetamide group. Its molecular structure suggests potential biological activity, making it of interest in pharmaceutical research. The presence of the chloro and fluorine substituents can influence its reactivity and interaction with biological targets, potentially enhancing its efficacy in medicinal applications. Additionally, the compound may exhibit specific physical properties such as melting point and boiling point, which are important for its handling and application in laboratory settings. Safety data sheets would provide necessary information regarding its toxicity, stability, and proper handling procedures. Overall, 2-Chloro-N-[1-(4-fluorophenyl)ethyl]acetamide represents a compound with significant potential in chemical and pharmaceutical research.

Formula: C₁₀H₁₁ClFNO

InChI: InChI=1S/C10H11ClFNO/c1-7(13-10(14)6-11)8-2-4-9(12)5-3-8/h2-5,7H,6H2,1H3,(H,13,14)

InChI key: InChIKey=RAKOSWBWXGXGRF-UHFFFAOYSA-N

SMILES: C(NC(CCl)=O)(C)C1=CC=C(F)C=C1

Synonyms:

• 2-Chloro-N-[1-(4-fluorophenyl)ethyl]acetamide
• Acetamide, 2-chloro-N-[1-(4-fluorophenyl)ethyl]-

2-Chloro-N-[1-(4-fluorophenyl)ethyl]acetamide

CAS: 851169-40-9

Versatile small molecule scaffold

Formula: C₁₀H₁₁ClFNO

Purity: Min. 95%

Molecular weight: 215.65 g/mol

Ref: 3D-BJB16940