CymitQuimica logo

CAS 851169-47-6

:

2-[2-(4-Bromophenyl)ethenyl]-4-chloro-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine

Description:
2-[2-(4-Bromophenyl)ethenyl]-4-chloro-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine, with the CAS number 851169-47-6, is a synthetic organic compound characterized by its complex bicyclic structure, which incorporates both a benzothieno and pyrimidine moiety. This compound features a bromophenyl group and a chloro substituent, contributing to its unique chemical reactivity and potential biological activity. The presence of the tetrahydro structure indicates that it contains saturated carbon atoms, which may influence its solubility and stability. The compound's molecular framework suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its structural characteristics may also impart interesting electronic properties, making it a candidate for further studies in material science or organic electronics. Overall, the compound's unique arrangement of functional groups and heterocycles positions it as a subject of interest for further research in various chemical and biological fields.
Formula:C18H14BrClN2S
InChI:InChI=1S/C18H14BrClN2S/c19-12-8-5-11(6-9-12)7-10-15-21-17(20)16-13-3-1-2-4-14(13)23-18(16)22-15/h5-10H,1-4H2
InChI key:InChIKey=HPUOTMIPOSAUMP-UHFFFAOYSA-N
SMILES:ClC1=C2C(SC3=C2CCCC3)=NC(C=CC4=CC=C(Br)C=C4)=N1
Synonyms:
  • 2-[2-(4-Bromophenyl)ethenyl]-4-chloro-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidine
  • [1]Benzothieno[2,3-d]pyrimidine, 2-[2-(4-bromophenyl)ethenyl]-4-chloro-5,6,7,8-tetrahydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.