CymitQuimica logo

CAS 851169-49-8

:

5-(2-Chlorophenyl)-N-(1-methylethyl)-1,3,4-oxadiazole-2-methanamine

Description:
5-(2-Chlorophenyl)-N-(1-methylethyl)-1,3,4-oxadiazole-2-methanamine, with the CAS number 851169-49-8, is a chemical compound characterized by its oxadiazole core, which is a five-membered heterocyclic ring containing two nitrogen atoms and three carbon atoms. This compound features a 2-chlorophenyl group, contributing to its potential biological activity and lipophilicity. The presence of the N-(1-methylethyl) substituent indicates that it has an isopropyl group attached to the nitrogen, which may influence its pharmacokinetic properties. The methanamine moiety suggests that it can participate in various chemical reactions, including nucleophilic substitutions. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its specific characteristics, such as solubility, stability, and reactivity, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound represents a unique structure that could have applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C12H14ClN3O
InChI:InChI=1S/C12H14ClN3O/c1-8(2)14-7-11-15-16-12(17-11)9-5-3-4-6-10(9)13/h3-6,8,14H,7H2,1-2H3
InChI key:InChIKey=GNEKIAJFZADLKK-UHFFFAOYSA-N
SMILES:ClC1=C(C=2OC(CNC(C)C)=NN2)C=CC=C1
Synonyms:
  • 1,3,4-Oxadiazole-2-methanamine, 5-(2-chlorophenyl)-N-(1-methylethyl)-
  • 5-(2-Chlorophenyl)-N-(1-methylethyl)-1,3,4-oxadiazole-2-methanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.