CAS 851169-59-0

3-[(4-Fluorophenyl)thio]propanoic acid hydrazide

Description:

3-[(4-Fluorophenyl)thio]propanoic acid hydrazide is a chemical compound characterized by its unique structure, which includes a propanoic acid moiety linked to a hydrazide functional group and a 4-fluorophenyl thio substituent. This compound typically exhibits properties associated with both hydrazides and thioethers, such as potential reactivity in nucleophilic substitution reactions and the ability to form hydrogen bonds due to the presence of the hydrazide functional group. The fluorine atom in the 4-fluorophenyl group can influence the compound's electronic properties, potentially enhancing its lipophilicity and affecting its biological activity. The presence of sulfur in the thioether linkage may also contribute to its reactivity and solubility characteristics. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly for its potential applications in targeting specific biological pathways or as a scaffold for further chemical modifications. However, specific physical and chemical properties such as melting point, solubility, and spectral data would need to be referenced from experimental studies or databases for precise information.

Formula: C₉H₁₁FN₂OS

InChI: InChI=1S/C9H11FN2OS/c10-7-1-3-8(4-2-7)14-6-5-9(13)12-11/h1-4H,5-6,11H2,(H,12,13)

InChI key: InChIKey=AOHUEWLERUBZRT-UHFFFAOYSA-N

SMILES: S(CCC(NN)=O)C1=CC=C(F)C=C1

Synonyms:

• Propanoic acid, 3-[(4-fluorophenyl)thio]-, hydrazide
• 3-[(4-Fluorophenyl)thio]propanoic acid hydrazide

3-[(4-Fluorophenyl)sulfanyl]propanehydrazide

CAS: 851169-59-0

Versatile small molecule scaffold

Formula: C₉H₁₁FN₂OS

Purity: Min. 95%

Molecular weight: 214.26 g/mol

Ref: 3D-BJB16959