CAS 851169-60-3
:2-Cyano-N-[4-(1,1-dimethylethyl)-2-thiazolyl]acetamide
Description:
2-Cyano-N-[4-(1,1-dimethylethyl)-2-thiazolyl]acetamide is a chemical compound characterized by its thiazole ring and cyano group, which contribute to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the bulky tert-butyl group enhances its lipophilicity, potentially influencing its biological activity and solubility. This compound features an acetamide functional group, which can participate in hydrogen bonding, affecting its interaction with biological targets. The thiazole moiety is known for its role in medicinal chemistry, often exhibiting antimicrobial and antifungal properties. The cyano group can serve as a versatile handle for further chemical modifications, making this compound a valuable intermediate in synthetic chemistry. Overall, 2-Cyano-N-[4-(1,1-dimethylethyl)-2-thiazolyl]acetamide presents a unique combination of structural features that may lead to diverse applications in research and industry.
Formula:C10H13N3OS
InChI:InChI=1S/C10H13N3OS/c1-10(2,3)7-6-15-9(12-7)13-8(14)4-5-11/h6H,4H2,1-3H3,(H,12,13,14)
InChI key:InChIKey=KELKOCKBZGULER-UHFFFAOYSA-N
SMILES:N(C(CC#N)=O)C1=NC(C(C)(C)C)=CS1
Synonyms:- Acetamide, 2-cyano-N-[4-(1,1-dimethylethyl)-2-thiazolyl]-
- 2-Cyano-N-[4-(1,1-dimethylethyl)-2-thiazolyl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.