CAS 85117-66-4

1,2,3-Propanetricarboxylic acid, 2-hydroxy-, reaction products with ethanolamine

Description:

The chemical substance known as "1,2,3-Propanetricarboxylic acid, 2-hydroxy-, reaction products with ethanolamine," with the CAS number 85117-66-4, is a complex organic compound derived from the reaction of citric acid and ethanolamine. This substance typically exhibits characteristics associated with both carboxylic acids and amines, including the presence of multiple carboxyl groups that contribute to its acidity and potential for forming salts or esters. The hydroxyl group enhances its solubility in polar solvents, making it useful in various applications, including as a chelating agent or in formulations for pharmaceuticals and cosmetics. The reaction products may also display surfactant properties, which can be beneficial in cleaning and emulsifying applications. Additionally, the compound's structure allows for potential interactions with biological systems, making it of interest in biochemical research. Overall, this substance is characterized by its multifunctionality, solubility, and potential utility in diverse chemical and industrial processes.

Formula: C₆H₈O₇·C₂H₇NO

InChI: InChI=1S/C6H8O7.C2H7NO/c7-3(8)1-6(13,5(11)12)2-4(9)10;3-1-2-4/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);4H,1-3H2

InChI key: InChIKey=WSAWCZQGMIRDJL-UHFFFAOYSA-N

SMILES: C(CO)N.C(CC(O)=O)(CC(O)=O)(C(O)=O)O

Synonyms:

• 1,2,3-Propanetricarboxylic acid, 2-hydroxy-, reaction products with ethanolamine

1,2,3-Propanetricarboxylic acid, 2-hydroxy-, reaction products with ethanolamine

CAS: 85117-66-4

Formula: C₈H₁₅NO₈

Molecular weight: 253.2066

Ref: IN-DA01X589