CymitQuimica logo

CAS 851170-87-1

:

8-Methyl-2,4-dioxo-1,3-diazaspiro[4.5]decane-3-acetic acid

Description:
8-Methyl-2,4-dioxo-1,3-diazaspiro[4.5]decane-3-acetic acid is a chemical compound characterized by its unique spirocyclic structure, which incorporates both nitrogen and carbon atoms. The presence of two carbonyl groups (dioxo) contributes to its reactivity and potential applications in organic synthesis. The compound features a methyl group, which can influence its solubility and biological activity. The diazaspiro framework suggests potential for interesting interactions in biological systems, making it a candidate for pharmaceutical research. Additionally, the acetic acid moiety indicates that it may exhibit acidic properties, which could affect its behavior in various chemical environments. The compound's CAS number, 851170-87-1, allows for precise identification and retrieval of information in chemical databases. Overall, this compound's structural features suggest it may have diverse applications in medicinal chemistry and materials science, although specific biological activities and practical uses would require further investigation through experimental studies.
Formula:C11H16N2O4
InChI:InChI=1S/C11H16N2O4/c1-7-2-4-11(5-3-7)9(16)13(6-8(14)15)10(17)12-11/h7H,2-6H2,1H3,(H,12,17)(H,14,15)
InChI key:InChIKey=JDHLGQPYECBZSL-UHFFFAOYSA-N
SMILES:O=C1C2(NC(=O)N1CC(O)=O)CCC(C)CC2
Synonyms:
  • 2-[8-Methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetic acid
  • 8-Methyl-2,4-dioxo-1,3-diazaspiro[4.5]decane-3-acetic acid
  • 1,3-Diazaspiro[4.5]decane-3-acetic acid, 8-methyl-2,4-dioxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.