CAS 851175-90-1

2-(Chloromethyl)-5-(4-morpholinylsulfonyl)-1-propyl-1H-benzimidazole

Description:

2-(Chloromethyl)-5-(4-morpholinylsulfonyl)-1-propyl-1H-benzimidazole, with the CAS number 851175-90-1, is a synthetic organic compound characterized by its complex structure, which includes a benzimidazole core substituted with a chloromethyl group and a morpholinylsulfonyl moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the chloromethyl group suggests reactivity that may facilitate further chemical modifications, while the morpholine ring can contribute to its pharmacological properties, potentially enhancing interactions with biological targets. The sulfonyl group may also influence the compound's solubility and stability. Overall, this compound's unique structural features position it as a candidate for further investigation in medicinal chemistry, particularly in the development of therapeutic agents. However, specific physical and chemical properties such as melting point, boiling point, and spectral data would require empirical determination or literature reference for precise characterization.

Formula: C₁₅H₂₀ClN₃O₃S

InChI: InChI=1S/C15H20ClN3O3S/c1-2-5-19-14-4-3-12(10-13(14)17-15(19)11-16)23(20,21)18-6-8-22-9-7-18/h3-4,10H,2,5-9,11H2,1H3

InChI key: InChIKey=KFGCQYFBMOJOQY-UHFFFAOYSA-N

SMILES: C(CC)N1C=2C(=CC(S(=O)(=O)N3CCOCC3)=CC2)N=C1CCl

Synonyms:

• 1H-Benzimidazole, 2-(chloromethyl)-5-(4-morpholinylsulfonyl)-1-propyl-
• 2-(Chloromethyl)-5-(4-morpholinylsulfonyl)-1-propyl-1H-benzimidazole
• Morpholine, 4-[[2-(chloromethyl)-1-propyl-1H-benzimidazol-5-yl]sulfonyl]-