
CAS 851175-97-8
:2-[[5-(Aminocarbonyl)-3-cyano-4-(2-furanyl)-1,4-dihydro-6-methyl-2-pyridinyl]thio]acetic acid
Description:
2-[[5-(Aminocarbonyl)-3-cyano-4-(2-furanyl)-1,4-dihydro-6-methyl-2-pyridinyl]thio]acetic acid, with the CAS number 851175-97-8, is a chemical compound characterized by its complex structure, which includes a pyridine ring, a furan moiety, and a thiol group. This compound features both an amino and a cyano functional group, contributing to its potential reactivity and biological activity. The presence of the dihydropyridine structure suggests it may exhibit properties typical of calcium channel blockers or other pharmacological activities. The thiol group may also impart unique characteristics, such as the ability to form disulfide bonds or participate in redox reactions. Additionally, the carboxylic acid functional group indicates that it can act as an acid, potentially influencing its solubility and interaction with biological systems. Overall, this compound's diverse functional groups suggest it may have applications in medicinal chemistry or as a biochemical probe, although specific biological activities would require further investigation.
Formula:C14H13N3O4S
InChI:InChI=1S/C14H13N3O4S/c1-7-11(13(16)20)12(9-3-2-4-21-9)8(5-15)14(17-7)22-6-10(18)19/h2-4,12,17H,6H2,1H3,(H2,16,20)(H,18,19)
InChI key:InChIKey=AJWKBKOLUAZECZ-UHFFFAOYSA-N
SMILES:C(#N)C=1C(C(C(N)=O)=C(C)NC1SCC(O)=O)C2=CC=CO2
Synonyms:- Acetic acid, [[5-(aminocarbonyl)-3-cyano-4-(2-furanyl)-1,4-dihydro-6-methyl-2-pyridinyl]thio]-
- 2-[[5-(Aminocarbonyl)-3-cyano-4-(2-furanyl)-1,4-dihydro-6-methyl-2-pyridinyl]thio]acetic acid
- Acetic acid, 2-[[5-(aminocarbonyl)-3-cyano-4-(2-furanyl)-1,4-dihydro-6-methyl-2-pyridinyl]thio]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.