CymitQuimica logo

CAS 851179-02-7

:

3,4-dichloro-5-fluoro-pyridine

Description:
3,4-Dichloro-5-fluoro-pyridine is a heterocyclic aromatic compound characterized by a pyridine ring substituted with two chlorine atoms and one fluorine atom. The presence of these halogen substituents significantly influences its chemical properties, including reactivity and polarity. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. Its molecular structure contributes to its potential applications in pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. The chlorine and fluorine atoms can enhance the compound's biological activity and stability, making it of interest in medicinal chemistry. Additionally, the compound's reactivity can be attributed to the electron-withdrawing nature of the halogens, which can facilitate nucleophilic substitution reactions. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 3,4-dichloro-5-fluoro-pyridine is a valuable compound in various chemical applications, particularly in the development of new materials and pharmaceuticals.
Formula:C5H2Cl2FN
InChI:InChI=1/C5H2Cl2FN/c6-3-1-9-2-4(8)5(3)7/h1-2H
SMILES:c1c(c(c(cn1)F)Cl)Cl
Synonyms:
  • Pyridine, 3,4-Dichloro-5-Fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.