CAS 851192-48-8

4-[(1E)-2-Nitroethenyl]-1H-indole

Description:

4-[(1E)-2-Nitroethenyl]-1H-indole is an organic compound characterized by its indole core, which is a bicyclic structure consisting of a benzene ring fused to a pyrrole ring. The presence of a nitroethenyl group at the 4-position of the indole structure introduces significant reactivity and polarity, making it a potential candidate for various chemical reactions and applications in organic synthesis. This compound may exhibit interesting electronic properties due to the conjugation between the indole and the nitroethenyl moiety, which can influence its behavior in biological systems and materials science. Additionally, the nitro group is known for its electron-withdrawing properties, which can affect the compound's acidity and reactivity. As with many indole derivatives, this compound may also display biological activity, making it of interest in medicinal chemistry. Safety and handling precautions should be observed due to the potential toxicity associated with nitro compounds. Overall, 4-[(1E)-2-Nitroethenyl]-1H-indole represents a unique structure with diverse potential applications in research and industry.

Formula: C₁₀H₈N₂O₂

InChI: InChI=1S/C10H8N2O2/c13-12(14)7-5-8-2-1-3-10-9(8)4-6-11-10/h1-7,11H/b7-5+

InChI key: InChIKey=DQVWAEMRCAYLKH-FNORWQNLSA-N

SMILES: C(=C/N(=O)=O)\C1=C2C(NC=C2)=CC=C1

Synonyms:

• 1H-Indole, 4-[(1E)-2-nitroethenyl]-
• 4-[(1E)-2-Nitroethenyl]-1H-indole
• (E)-4-(2-Nitrovinyl)-1H-indole
• trans-4-(2-Nitrovinyl)indole
• 4-[(E)-2-nitroethenyl]-1H-indole