CymitQuimica logo

CAS 851199-62-7

:

2-[4-(2,4-Difluorophenoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:
2-[4-(2,4-Difluorophenoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique dioxaborolane structure, which features a boron atom coordinated to two oxygen atoms in a cyclic arrangement. This compound is notable for its incorporation of a difluorophenoxy group, which enhances its potential applications in medicinal chemistry and materials science. The presence of multiple methyl groups contributes to its steric bulk, influencing its reactivity and solubility properties. Typically, compounds like this exhibit stability under ambient conditions but may undergo hydrolysis in the presence of moisture, releasing boric acid derivatives. Its molecular structure suggests potential utility in drug development, particularly in the design of boron-based therapeutics or as a building block in organic synthesis. Additionally, the presence of fluorine atoms can impart unique electronic properties, making it a candidate for further exploration in various chemical applications. Overall, this compound exemplifies the intersection of boron chemistry and organic synthesis, with implications for both research and industrial applications.
Formula:C18H19BF2O3
InChI:InChI=1S/C18H19BF2O3/c1-17(2)18(3,4)24-19(23-17)12-5-8-14(9-6-12)22-16-10-7-13(20)11-15(16)21/h5-11H,1-4H3
InChI key:InChIKey=RUFDDDZRZUUERA-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC=C(OC3=C(F)C=C(F)C=C3)C=C2
Synonyms:
  • 1,3,2-Dioxaborolane, 2-[4-(2,4-difluorophenoxy)phenyl]-4,4,5,5-tetramethyl-
  • 2-[4-(2,4-Difluorophenoxy)phenyl]-4,4,5,5-tetramethyl-[1,3,2]dioxborolane
  • 2-[4-(2,4-Difluorophenoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.