CAS 851199-85-4
:B-2-Pyrimidinylboronic acid
Description:
B-2-Pyrimidinylboronic acid, with the CAS number 851199-85-4, is an organoboron compound characterized by the presence of a pyrimidine ring and a boronic acid functional group. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar solvents like water and alcohols, and possessing moderate stability under standard conditions. The boronic acid moiety allows for the formation of reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and materials science. B-2-Pyrimidinylboronic acid can serve as a building block in the synthesis of biologically active compounds and is often utilized in the development of targeted therapies due to its ability to interact with biological molecules. Additionally, its unique structural features enable it to participate in cross-coupling reactions, which are essential in organic synthesis. Overall, B-2-Pyrimidinylboronic acid is a versatile compound with significant implications in both research and industrial applications.
Formula:C4H5BN2O2
InChI:InChI=1S/C4H5BN2O2/c8-5(9)4-6-2-1-3-7-4/h1-3,8-9H
InChI key:InChIKey=FXJZOUPFQNMFOR-UHFFFAOYSA-N
SMILES:B(O)(O)C=1N=CC=CN1
Synonyms:- B-2-Pyrimidinylboronic acid
- Boronic acid, 2-pyrimidinyl-
- Boronicacid, 2-pyrimidinyl- (9CI)
- Pyrimidin-2-ylboronic acid
- Boronic acid, B-2-pyrimidinyl-
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Pyrimidin-2-ylboronic acid
CAS:Pyrimidin-2-ylboronic acidFormula:C4H5BN2O2Purity:98%Molecular weight:123.91Pyrimidin-2-ylboronic acid
CAS:Formula:C4H5BN2O2Purity:98%Color and Shape:SolidMolecular weight:123.9057Pyrimidin-2-ylboronic acid
CAS:Pyrimidin-2-ylboronic acidFormula:C4H5BN2O2Purity:98%Molecular weight:123.912-Pyrimidinylboronic acid
CAS:2-Pyrimidinylboronic acid is a pyrimidine compound that is structurally similar to nicotinic acetylcholine. It has been shown to have an inhibitory effect on the activity of α7 nicotinic acetylcholine receptors in mammalian cells, which may be due to its ability to bind at the chlorine atom. The compound has also been shown to exhibit anticancer properties and can be used as a potential inhibitor for cancer cells. However, 2-pyrimidinylboronic acid is not active against heart disease or fluorescence resonance energy transfer (FRET) studies.
Formula:C4H5BN2O2Purity:Min. 95%Molecular weight:123.91 g/mol



