CAS 851208-05-4
:3-[2,4-Bis(difluoromethoxy)phenyl]-2-propenoic acid
Description:
3-[2,4-Bis(difluoromethoxy)phenyl]-2-propenoic acid, identified by its CAS number 851208-05-4, is an organic compound characterized by its unique structure, which includes a propenoic acid moiety and a phenyl group substituted with two difluoromethoxy groups. This compound typically exhibits properties associated with both aromatic and alkenoic acids, such as potential reactivity in electrophilic aromatic substitution and the ability to participate in various chemical reactions due to the presence of the carboxylic acid functional group. The difluoromethoxy substituents enhance its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. Additionally, the presence of fluorine atoms can impart unique electronic properties, potentially affecting the compound's stability and reactivity. Overall, this compound's characteristics make it a subject of interest in synthetic organic chemistry and medicinal chemistry, where its derivatives may be explored for various applications.
Formula:C11H8F4O4
InChI:InChI=1S/C11H8F4O4/c12-10(13)18-7-3-1-6(2-4-9(16)17)8(5-7)19-11(14)15/h1-5,10-11H,(H,16,17)
InChI key:InChIKey=GLLUHHMRAQTLGH-UHFFFAOYSA-N
SMILES:C(=CC(O)=O)C1=C(OC(F)F)C=C(OC(F)F)C=C1
Synonyms:- 3-[2,4-Bis(difluoromethoxy)phenyl]-2-propenoic acid
- 2-Propenoic acid, 3-[2,4-bis(difluoromethoxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.