
CAS 851208-09-8
:2,6-Dimethyl-3-(1-piperazinylmethyl)imidazo[1,2-a]pyridine
Description:
2,6-Dimethyl-3-(1-piperazinylmethyl)imidazo[1,2-a]pyridine is a chemical compound characterized by its complex structure, which includes an imidazo[1,2-a]pyridine core substituted with two methyl groups at the 2 and 6 positions and a piperazinylmethyl group at the 3 position. This compound typically exhibits properties such as moderate solubility in polar solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the piperazine moiety may contribute to its pharmacological properties, potentially enhancing interactions with biological targets. Additionally, the imidazo[1,2-a]pyridine framework is known for its role in various biological activities, including antimicrobial and anticancer effects. The compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, influencing its reactivity and stability. Overall, 2,6-Dimethyl-3-(1-piperazinylmethyl)imidazo[1,2-a]pyridine represents a class of compounds that could be explored for therapeutic applications, although specific biological activities would require further investigation.
Formula:C14H20N4
InChI:InChI=1S/C14H20N4/c1-11-3-4-14-16-12(2)13(18(14)9-11)10-17-7-5-15-6-8-17/h3-4,9,15H,5-8,10H2,1-2H3
InChI key:InChIKey=FMUCGJYSIRXJAW-UHFFFAOYSA-N
SMILES:C(C=1N2C(=NC1C)C=CC(C)=C2)N3CCNCC3
Synonyms:- Imidazo[1,2-a]pyridine, 2,6-dimethyl-3-(1-piperazinylmethyl)-
- 2,6-Dimethyl-3-(1-piperazinylmethyl)imidazo[1,2-a]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.