CAS 85124-16-9
:5-chloro-1H-indole-2,3-dione 3-oxime
Description:
5-Chloro-1H-indole-2,3-dione 3-oxime, with the CAS number 85124-16-9, is a chemical compound that features an indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound is characterized by the presence of a chloro substituent at the 5-position and an oxime functional group at the 3-position of the indole framework. The oxime group is derived from the reaction of the corresponding carbonyl compound with hydroxylamine, indicating potential reactivity and applications in organic synthesis. The presence of the chloro group may influence the compound's reactivity, solubility, and biological activity. Typically, compounds like this can exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the compound's stability, solubility in various solvents, and potential for forming derivatives are important characteristics that can affect its utility in research and application. Overall, 5-chloro-1H-indole-2,3-dione 3-oxime is a notable compound in the realm of organic chemistry and drug development.
Formula:C8H5ClN2O2
InChI:InChI=1/C8H5ClN2O2/c9-4-1-2-6-5(3-4)7(11-13)8(12)10-6/h1-3,13H,(H,10,11,12)
InChI key:InChIKey=ILCHDUWPANLREO-UHFFFAOYSA-N
SMILES:N(O)=C1C=2C(NC1=O)=CC=C(Cl)C2
Synonyms:- 1H-Indole-2,3-dione, 5-chloro-, 3-oxime
- 5-Chlorisatin-3-oxim
- 5-Chlorisatin-3-oxim [German]
- 5-Chloroisatin 3-oxime
- 5-chloro-3-(hydroxyamino)-2H-indol-2-one
- 5-Chloro-1H-indole-2,3-dione 3-oxime
- 5-Chloro-1H-indole-2,3-dione 3-oxime
- 5-Chloro-3-hydroxyimino-1H-indol-2(3H)-one
- 5-Chloro-3-(hydroxyimino)indolin-2-one
- 5-chloro-3-(hydroxyamino)-2-indolone
- 5-chloro-3-(hydroxyamino)indol-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.