CAS 85124-48-7
:9-oxo-6,7,8,9-tetrahydro-5H-benzo[7]annulene-6-carboxylic acid
Description:
9-Oxo-6,7,8,9-tetrahydro-5H-benzo[7]annulene-6-carboxylic acid is a complex organic compound characterized by its unique bicyclic structure, which includes a fused ring system. This compound features a carboxylic acid functional group, contributing to its acidic properties and potential reactivity in various chemical reactions. The presence of the oxo group indicates a carbonyl functionality, which can participate in hydrogen bonding and influence the compound's solubility and reactivity. The tetrahydro configuration suggests that the compound is saturated in certain regions, affecting its stability and interaction with other molecules. Its structural features may allow for interesting applications in organic synthesis, medicinal chemistry, or materials science. The compound's CAS number, 85124-48-7, serves as a unique identifier for regulatory and research purposes. Overall, the characteristics of this compound make it a subject of interest for further study in various chemical contexts.
Formula:C12H12O3
InChI:InChI=1/C12H12O3/c13-11-6-5-9(12(14)15)7-8-3-1-2-4-10(8)11/h1-4,9H,5-7H2,(H,14,15)
SMILES:c1ccc2c(c1)CC(CCC2=O)C(=O)O
Synonyms:- 5H-benzocycloheptene-6-carboxylic acid, 6,7,8,9-tetrahydro-9-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.