CAS 851264-59-0

1-(3-Chlorophenyl)-4-piperidinecarboxylic acid

Description:

1-(3-Chlorophenyl)-4-piperidinecarboxylic acid, identified by its CAS number 851264-59-0, is a chemical compound characterized by its piperidine ring structure substituted with a 3-chlorophenyl group and a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the chlorophenyl moiety may influence its lipophilicity and interaction with biological targets, making it of interest in medicinal chemistry. The carboxylic acid group can participate in hydrogen bonding and may enhance solubility in polar solvents. Additionally, the compound's structural features suggest potential applications in pharmaceuticals, particularly in the development of drugs targeting neurological or psychiatric conditions. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity would be influenced by the electronic effects of the chlorine substituent and the overall molecular conformation. As with many compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₂H₁₄ClNO₂

InChI: InChI=1S/C12H14ClNO2/c13-10-2-1-3-11(8-10)14-6-4-9(5-7-14)12(15)16/h1-3,8-9H,4-7H2,(H,15,16)

InChI key: InChIKey=ZHKRRELTGHBABY-UHFFFAOYSA-N

SMILES: ClC=1C=C(N2CCC(C(O)=O)CC2)C=CC1

Synonyms:

• 1-(3-Chlorophenyl)piperidine-4-carboxylic acid
• 4-Piperidinecarboxylic acid, 1-(3-chlorophenyl)-
• 1-(3-Chlorophenyl)-4-piperidinecarboxylic acid