CAS 851264-62-5

1-(2-Fluorophenyl)-4-piperidinecarboxylic acid

Description:

1-(2-Fluorophenyl)-4-piperidinecarboxylic acid, identified by its CAS number 851264-62-5, is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. The presence of a fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring, influencing the compound's electronic properties and potentially its biological activity. This compound features a carboxylic acid functional group, which contributes to its acidity and can participate in hydrogen bonding, enhancing its solubility in polar solvents. The structural arrangement suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with piperidine and aromatic substituents are often explored for their therapeutic effects. Additionally, the fluorine substitution may enhance lipophilicity and metabolic stability. Overall, the unique combination of functional groups and structural features makes this compound of interest in various chemical and biological research contexts.

Formula: C₁₂H₁₄FNO₂

InChI: InChI=1S/C12H14FNO2/c13-10-3-1-2-4-11(10)14-7-5-9(6-8-14)12(15)16/h1-4,9H,5-8H2,(H,15,16)

InChI key: InChIKey=HYHMLDOEXWCBDF-UHFFFAOYSA-N

SMILES: FC1=C(N2CCC(C(O)=O)CC2)C=CC=C1

Synonyms:

• 4-Piperidinecarboxylic acid, 1-(2-fluorophenyl)-
• 1-(2-Fluorophenyl)-4-piperidinecarboxylic acid