CAS 851269-15-3

2-Chloro-N-[(5-chloro-2-thienyl)methyl]-N-methylacetamide

Description:

2-Chloro-N-[(5-chloro-2-thienyl)methyl]-N-methylacetamide is a chemical compound characterized by its unique structure, which includes a chloro group, a thienyl moiety, and an acetamide functional group. This compound features a thienyl ring, which is a five-membered aromatic ring containing sulfur, contributing to its potential biological activity. The presence of the chloro substituents enhances its reactivity and may influence its pharmacological properties. As an acetamide derivative, it exhibits characteristics typical of amides, such as the ability to participate in hydrogen bonding, which can affect its solubility and interaction with biological targets. The compound is likely to be of interest in medicinal chemistry, particularly for its potential applications in drug development. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogenated groups.

Formula: C₈H₉Cl₂NOS

InChI: InChI=1S/C8H9Cl2NOS/c1-11(8(12)4-9)5-6-2-3-7(10)13-6/h2-3H,4-5H2,1H3

InChI key: InChIKey=XTMBJEKDTRNUDZ-UHFFFAOYSA-N

SMILES: C(N(C(CCl)=O)C)C=1SC(Cl)=CC1

Synonyms:

• 2-Chloro-N-[(5-chloro-2-thienyl)methyl]-N-methylacetamide
• 2-Chloro-N-[(5-chlorothiophen-2-yl)methyl]-N-methylacetamide
• Acetamide, 2-chloro-N-[(5-chloro-2-thienyl)methyl]-N-methyl-