CAS 851288-59-0

2-(1H-Imidazol-2-yl)-1-phenylethanone oxime

Description:

2-(1H-Imidazol-2-yl)-1-phenylethanone oxime, identified by its CAS number 851288-59-0, is a chemical compound characterized by its oxime functional group, which is derived from the reaction of an aldehyde or ketone with hydroxylamine. This compound features an imidazole ring, contributing to its potential biological activity and interaction with various biological systems. The presence of the phenyl group enhances its lipophilicity, which may influence its solubility and permeability in biological membranes. Typically, compounds like this may exhibit properties such as antimicrobial, antifungal, or anticancer activities, although specific biological effects would depend on further empirical studies. The structural configuration allows for potential hydrogen bonding and coordination with metal ions, which can be significant in catalysis or as ligands in coordination chemistry. Overall, 2-(1H-Imidazol-2-yl)-1-phenylethanone oxime represents a versatile scaffold in medicinal chemistry and material science, warranting further investigation for its applications.

Formula: C₁₁H₁₁N₃O

InChI: InChI=1S/C11H11N3O/c15-14-10(8-11-12-6-7-13-11)9-4-2-1-3-5-9/h1-7,15H,8H2,(H,12,13)

InChI key: InChIKey=WDKJZPYRHWUAOT-UHFFFAOYSA-N

SMILES: C(CC=1NC=CN1)(=NO)C2=CC=CC=C2

Synonyms:

• Ethanone, 2-(1H-imidazol-2-yl)-1-phenyl-, oxime
• 2-(1H-Imidazol-2-yl)-1-phenylethanone oxime