CAS 851288-82-9

Ethyl 2-[(2-hydrazinyl-2-oxoacetyl)amino]-4,5-dimethyl-3-thiophenecarboxylate

Description:

Ethyl 2-[(2-hydrazinyl-2-oxoacetyl)amino]-4,5-dimethyl-3-thiophenecarboxylate is a chemical compound characterized by its complex structure, which includes a thiophene ring, an ethyl ester group, and a hydrazine moiety. This compound typically exhibits properties associated with both hydrazine derivatives and thiophene-based compounds, such as potential biological activity and reactivity due to the presence of the hydrazine functional group. The thiophene ring contributes to its aromatic character, which may influence its solubility and stability in various solvents. Additionally, the presence of the carboxylate group suggests potential for forming salts or participating in acid-base reactions. The compound may also exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be utilized in research related to drug development or as a building block in organic synthesis. Safety and handling precautions should be observed due to the reactive nature of hydrazine derivatives.

Formula: C₁₁H₁₅N₃O₄S

InChI: InChI=1S/C11H15N3O4S/c1-4-18-11(17)7-5(2)6(3)19-10(7)13-8(15)9(16)14-12/h4,12H2,1-3H3,(H,13,15)(H,14,16)

InChI key: InChIKey=YHKWIAWYZPCADG-UHFFFAOYSA-N

SMILES: N(C(C(NN)=O)=O)C1=C(C(OCC)=O)C(C)=C(C)S1

Synonyms:

• 3-Thiophenecarboxylic acid, 2-[(hydrazinooxoacetyl)amino]-4,5-dimethyl-, ethyl ester
• 3-Thiophenecarboxylic acid, 2-[(2-hydrazinyl-2-oxoacetyl)amino]-4,5-dimethyl-, ethyl ester
• Ethyl 2-[(2-hydrazinyl-2-oxoacetyl)amino]-4,5-dimethyl-3-thiophenecarboxylate

Ethyl 2-[(hydrazinecarbonyl)formamido]-4,5-dimethylthiophene-3-carboxylate

CAS: 851288-82-9

Versatile small molecule scaffold

Formula: C₁₁H₁₅N₃O₄S

Purity: Min. 95%

Molecular weight: 285.32 g/mol

Ref: 3D-BJB28882