
CAS 851335-10-9
:Benzoic acid, 4-borono-2-ethoxy-
Description:
Benzoic acid, 4-borono-2-ethoxy- is an organic compound characterized by the presence of a benzoic acid moiety substituted with both a boronic acid group and an ethoxy group. The boron atom in the boronic acid group typically exhibits a trigonal planar geometry, allowing it to participate in various chemical reactions, particularly in the formation of boronate esters and in Suzuki coupling reactions. The ethoxy group contributes to the compound's solubility in organic solvents and may influence its reactivity and interaction with biological systems. This compound is likely to exhibit acidic properties due to the carboxylic acid functional group, which can donate protons in solution. Additionally, the presence of both the boron and ethoxy substituents can enhance the compound's utility in organic synthesis and medicinal chemistry, potentially serving as a building block for more complex molecules. Overall, the unique combination of functional groups in benzoic acid, 4-borono-2-ethoxy- provides it with distinctive chemical properties and reactivity patterns.
Formula:C9H11BO5
InChI:InChI=1S/C9H11BO5/c1-2-15-8-5-6(10(13)14)3-4-7(8)9(11)12/h3-5,13-14H,2H2,1H3,(H,11,12)
InChI key:InChIKey=VWIFXHUGYAGNJM-UHFFFAOYSA-N
SMILES:O(CC)C1=C(C(O)=O)C=CC(B(O)O)=C1
Synonyms:- Benzoic acid, 4-borono-2-ethoxy-
- 4-Borono-2-ethoxybenzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
