CAS 851340-77-7
:2-fluoro-4-(4-formylphenyl)benzonitrile
Description:
2-Fluoro-4-(4-formylphenyl)benzonitrile, with the CAS number 851340-77-7, is an organic compound characterized by its complex aromatic structure. It features a fluorine atom, a nitrile group, and an aldehyde functional group, which contribute to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the fluorine atom can enhance the compound's lipophilicity and influence its biological activity, while the nitrile group may participate in various chemical reactions, such as nucleophilic additions. The aldehyde functionality allows for further derivatization, making it a versatile intermediate in the synthesis of more complex molecules. This compound is typically solid at room temperature and may exhibit specific solubility characteristics depending on the solvent used. Its unique structural features make it of interest in research areas such as drug development and materials science, where modifications to the aromatic system can lead to novel properties and functions. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C14H8FNO
InChI:InChI=1/C14H8FNO/c15-14-7-12(5-6-13(14)8-16)11-3-1-10(9-17)2-4-11/h1-7,9H
SMILES:c1cc(ccc1C=O)c1ccc(C#N)c(c1)F
Synonyms:- [1,1'-Biphenyl]-4-Carbonitrile, 3-Fluoro-4'-Formyl-
- 3-Fluoro-4'-formylbiphenyl-4-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
