
CAS 85136-37-4
:2-(2-Cyclohexylethyl)-1,3-dioxolane
Description:
2-(2-Cyclohexylethyl)-1,3-dioxolane is an organic compound characterized by its dioxolane ring structure, which consists of a five-membered ring containing two oxygen atoms. This compound features a cyclohexyl group attached to an ethyl chain, contributing to its unique properties. It is typically a colorless to pale yellow liquid with a distinctive odor, indicative of its organic nature. The presence of the dioxolane moiety suggests that it may exhibit moderate polarity, which can influence its solubility in various solvents. Additionally, the cyclohexyl group can impart hydrophobic characteristics, affecting its interactions with other substances. This compound may be of interest in various applications, including as a solvent, in organic synthesis, or in the formulation of specialty chemicals. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential health and environmental impacts.
Formula:C11H20O2
InChI:InChI=1S/C11H20O2/c1-2-4-10(5-3-1)6-7-11-12-8-9-13-11/h10-11H,1-9H2
InChI key:InChIKey=VHRVDEZBJOARMF-UHFFFAOYSA-N
SMILES:C(CC1OCCO1)C2CCCCC2
Synonyms:- 2-(2-Cyclohexylethyl)-1,3-dioxolane
- 1,3-Dioxolane, 2-(2-cyclohexylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.