
CAS 85136-58-9
:1,1′-(3,6,9,12,15-Pentaoxaheptadecane-1,17-diyl) di-2-propenoate
Description:
1,1′-(3,6,9,12,15-Pentaoxaheptadecane-1,17-diyl) di-2-propenoate, with CAS number 85136-58-9, is a synthetic compound characterized by its unique structure that includes a long aliphatic chain and multiple ether linkages due to the presence of five oxygen atoms in its backbone. This compound features two propenoate (acrylate) functional groups, which are reactive and can participate in polymerization reactions, making it useful in various applications such as coatings, adhesives, and as a monomer in the production of polymers. The presence of the ether linkages contributes to its solubility in organic solvents and may enhance its thermal stability. Additionally, the long hydrophobic chain can impart surfactant properties, potentially making it useful in formulations requiring emulsification or dispersion. Overall, this compound's combination of hydrophilic and hydrophobic characteristics allows for versatility in chemical applications, particularly in materials science and polymer chemistry.
Formula:C18H30O9
InChI:InChI=1S/C18H30O9/c1-3-17(19)26-15-13-24-11-9-22-7-5-21-6-8-23-10-12-25-14-16-27-18(20)4-2/h3-4H,1-2,5-16H2
InChI key:InChIKey=DMMSYVRRDYJQSI-UHFFFAOYSA-N
SMILES:C(OCCOCCOCCOCCOCCOCCOC(C=C)=O)(C=C)=O
Synonyms:- 2-Propenoic acid, 3,6,9,12,15-pentaoxaheptadecane-1,17-diyl ester
- Hexaethyleneglycol diacrylate
- 1,1′-(3,6,9,12,15-Pentaoxaheptadecane-1,17-diyl) di-2-propenoate
- 2-Propenoic acid, 1,1′-(3,6,9,12,15-pentaoxaheptadecane-1,17-diyl) ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Propenoic acid,1,1'-(3,6,9,12,15-pentaoxaheptadecane-1,17-diyl) ester
CAS:Formula:C18H30O9Purity:98%Color and Shape:LiquidMolecular weight:390.4254Bis-acrylate-PEG6
CAS:Bis-acrylate-PEG6 is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.Formula:C18H30O9Color and Shape:SolidMolecular weight:390.4317-(PROP-2-ENOYLOXY)-3,6,9,12,15-PENTAOXAHEPTADECAN-1-YL PROP-2-ENOATE
CAS:Purity:98%Molecular weight:390.42898562-Propenoic acid, 3,6,9,12,15-pentaoxaheptadecane-1,17-diyl ester
CAS:2-Propenoic acid is a high purity, research tool that is an activator and ligand for the receptor. It is used in Cell Biology as an antibody to study protein interactions, and as a pharmacological agent in peptides. 2-Propenoic acid has been shown to inhibit ion channels, which may be due to its ability to block the binding of ions to specific sites on the channel protein. This product has also been shown to be a potent inhibitor of the enzyme phosphodiesterase 4 (PDE4), which is involved in signal transduction pathways that regulate cellular proliferation and differentiation.
Formula:C18H30O9Purity:Min. 95%Molecular weight:390.4 g/mol




