
CAS 85136-59-0
:1,1′-(3,6,9,12,15,18-Hexaoxaeicosane-1,20-diyl) di-2-propenoate
Description:
1,1′-(3,6,9,12,15,18-Hexaoxaeicosane-1,20-diyl) di-2-propenoate, with CAS number 85136-59-0, is a synthetic compound characterized by its long-chain structure that includes multiple ether linkages due to the presence of hexaoctane units. This compound features two propenoate functional groups, which are derived from acrylic acid, making it reactive and suitable for polymerization processes. The presence of the hexaoctane moiety contributes to its hydrophilic properties, while the propenoate groups provide sites for cross-linking and polymer formation. This substance is typically used in applications such as coatings, adhesives, and as a monomer in the production of polymers. Its unique structure allows for enhanced flexibility and durability in materials, making it valuable in various industrial applications. Additionally, the compound's properties can be influenced by factors such as temperature and the presence of catalysts during polymerization, which can affect its final physical characteristics and performance in practical applications.
Formula:C20H34O10
InChI:InChI=1S/C20H34O10/c1-3-19(21)29-17-15-27-13-11-25-9-7-23-5-6-24-8-10-26-12-14-28-16-18-30-20(22)4-2/h3-4H,1-2,5-18H2
InChI key:InChIKey=PVZDCNHDGLMRSP-UHFFFAOYSA-N
SMILES:C(OCCOCCOCCOCCOCCOCCOCCOC(C=C)=O)(C=C)=O
Synonyms:- 2-Propenoic acid, 3,6,9,12,15,18-hexaoxaeicosane-1,20-diyl ester
- 2-Propenoic acid, 1,1′-(3,6,9,12,15,18-hexaoxaeicosane-1,20-diyl) ester
- 1,1′-(3,6,9,12,15,18-Hexaoxaeicosane-1,20-diyl) di-2-propenoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3,6,9,12,15,18-HEXAOXAICOSANE-1,20-DIYL DIACRYLATE
CAS:Formula:C20H34O10Molecular weight:434.47795999999977
