CymitQuimica logo

CAS 85136-60-3

:

14-Hydroxy-3,6,9,12-tetraoxatetradec-1-yl 2-propenoate

Description:
14-Hydroxy-3,6,9,12-tetraoxatetradec-1-yl 2-propenoate, with the CAS number 85136-60-3, is a chemical compound characterized by its unique structure that includes multiple ether linkages and a propenoate functional group. This compound is part of a class of polyether compounds, which are known for their flexibility and ability to form various polymeric materials. The presence of hydroxyl groups contributes to its potential reactivity, allowing for further chemical modifications or polymerization processes. Its tetraoxatetradec backbone suggests a long-chain structure, which may impart specific physical properties such as solubility in various solvents and thermal stability. Additionally, the propenoate moiety indicates that it can participate in addition reactions, making it useful in applications such as coatings, adhesives, and as a monomer in polymer synthesis. Overall, this compound's characteristics make it a versatile building block in organic synthesis and materials science.
Formula:C13H24O7
InChI:InChI=1S/C13H24O7/c1-2-13(15)20-12-11-19-10-9-18-8-7-17-6-5-16-4-3-14/h2,14H,1,3-12H2
InChI key:InChIKey=GYIXDFJDLKMWAA-UHFFFAOYSA-N
SMILES:O(CCOCCOCCOCCO)CCOC(C=C)=O
Synonyms:
  • 2-Propenoic acid, 14-hydroxy-3,6,9,12-tetraoxatetradec-1-yl ester
  • 14-Hydroxy-3,6,9,12-tetraoxatetradec-1-yl 2-propenoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.