
CAS 85136-61-4
:20-Hydroxy-3,6,9,12,15,18-hexaoxaeicos-1-yl 2-propenoate
Description:
20-Hydroxy-3,6,9,12,15,18-hexaoxaeicos-1-yl 2-propenoate, with the CAS number 85136-61-4, is a synthetic compound characterized by its unique structure that includes a long hydrocarbon chain and multiple ether linkages due to the presence of six ether groups. This compound features a propenoate functional group, which contributes to its reactivity, particularly in polymerization processes. The presence of the hydroxyl group enhances its solubility in polar solvents and may influence its biological activity. Its long carbon chain and ether groups suggest potential applications in materials science, particularly in the development of surfactants, emulsifiers, or as a component in polymeric materials. The compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, this compound exemplifies the intersection of organic chemistry and materials science, with potential uses in various industrial and research applications.
Formula:C17H32O9
InChI:InChI=1S/C17H32O9/c1-2-17(19)26-16-15-25-14-13-24-12-11-23-10-9-22-8-7-21-6-5-20-4-3-18/h2,18H,1,3-16H2
InChI key:InChIKey=JBJPOMNMCVIYPK-UHFFFAOYSA-N
SMILES:C(COCCOCCOCCOCCOCCO)OCCOC(C=C)=O
Synonyms:- 2-Propenoic acid, 20-hydroxy-3,6,9,12,15,18-hexaoxaeicos-1-yl ester
- 20-Hydroxy-3,6,9,12,15,18-hexaoxaeicos-1-yl 2-propenoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Propenoic acid,20-hydroxy-3,6,9,12,15,18-hexaoxaeicos-1-yl ester
CAS:Formula:C17H32O9Molecular weight:380.4305799999999
