CAS 85136-74-9

1,2-Dihydro-6-hydroxy-4-methyl-1-[3-(1-methylethoxy)propyl]-2-oxo-5-[2-[4-(2-phenyldiazenyl)phenyl]diazenyl]-3-pyridinecarbonitrile

Description:

1,2-Dihydro-6-hydroxy-4-methyl-1-[3-(1-methylethoxy)propyl]-2-oxo-5-[2-[4-(2-phenyldiazenyl)phenyl]diazenyl]-3-pyridinecarbonitrile, with CAS number 85136-74-9, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as hydroxyl, carbonitrile, and azo groups. This compound features a pyridine ring, contributing to its aromatic properties and potential biological activity. The presence of the diazenyl groups suggests that it may exhibit unique electronic properties, making it of interest in dye chemistry or as a potential indicator in various applications. Its hydrophobic and hydrophilic regions, due to the presence of alkyl and hydroxyl groups, may influence its solubility and interaction with biological systems. Additionally, the compound's structural complexity may lead to interesting photophysical properties, which could be explored in fields such as materials science or medicinal chemistry. Overall, this compound represents a fascinating subject for further research due to its potential applications and unique chemical characteristics.

Formula: C₂₅H₂₆N₆O₃

InChI: InChI=1S/C25H26N6O3/c1-17(2)34-15-7-14-31-24(32)22(16-26)18(3)23(25(31)33)30-29-21-12-10-20(11-13-21)28-27-19-8-5-4-6-9-19/h4-6,8-13,17,33H,7,14-15H2,1-3H3

InChI key: InChIKey=OQGRWUAQMXJPDP-UHFFFAOYSA-N

SMILES: N(=NC1=CC=C(N=NC2=CC=CC=C2)C=C1)C3=C(O)N(CCCOC(C)C)C(=O)C(C#N)=C3C

Synonyms:

• 3-Pyridinecarbonitrile, 1,2-dihydro-6-hydroxy-4-methyl-1-[3-(1-methylethoxy)propyl]-2-oxo-5-[2-[4-(2-phenyldiazenyl)phenyl]diazenyl]-
• 3-Pyridinecarbonitrile, 1,2-dihydro-6-hydroxy-4-methyl-1-[3-(1-methylethoxy)propyl]-2-oxo-5-[[4-(phenylazo)phenyl]azo]-
• 1,2-Dihydro-6-hydroxy-4-methyl-1-[3-(1-methylethoxy)propyl]-2-oxo-5-[2-[4-(2-phenyldiazenyl)phenyl]diazenyl]-3-pyridinecarbonitrile

Disperse Orange 149

Controlled Product

CAS: 85136-74-9

Formula: C₂₅H₂₆N₆O₃

Color and Shape: Neat

Molecular weight: 458.51

Ref: 04-C12972150

Disperse Orange 149 100 µg/mL in Acetonitrile

CAS: 85136-74-9

Formula: C₂₅H₂₆N₆O₃

Color and Shape: Single Solution

Molecular weight: 458.51

Ref: 04-A12972150AL-100

Disperse Orange 149

Controlled Product

CAS: 85136-74-9

Formula: C₂₅H₂₆N₆O₃

Color and Shape: Red

Molecular weight: 458.51

Ref: TR-D495370