CAS 851368-08-6

benzene, 2-bromo-1-fluoro-3-iodo-

Description:

Benzene, 2-bromo-1-fluoro-3-iodo- is an organic compound characterized by a benzene ring substituted with three halogen atoms: bromine, fluorine, and iodine. This compound features a complex arrangement of these halogens at specific positions on the aromatic ring, which influences its chemical reactivity and physical properties. The presence of multiple halogens can enhance the compound's reactivity, making it useful in various synthetic applications, including pharmaceuticals and agrochemicals. The molecular structure contributes to its potential as an intermediate in organic synthesis. Additionally, the differing electronegativities of the halogens can lead to unique dipole moments, affecting solubility and interactions with other molecules. As with many halogenated compounds, considerations regarding toxicity and environmental impact are important, particularly in terms of persistence and bioaccumulation. Overall, benzene, 2-bromo-1-fluoro-3-iodo- exemplifies the diverse chemistry of halogenated aromatic compounds.

Formula: C₆H₃BrFI

InChI: InChI=1/C6H3BrFI/c7-6-4(8)2-1-3-5(6)9/h1-3H

SMILES: c1cc(c(c(c1)I)Br)F

Synonyms:

• 2-Bromo-1-fluoro-3-iodobenzene

2-Bromo-1-fluoro-3-iodobenzene

CAS: 851368-08-6

Formula: C₆H₃BrFI

Purity: 98%

Color and Shape: Solid

Molecular weight: 300.8949

Ref: IN-DA00G4GY

2-Bromo-3-fluoroiodobenzene

CAS: 851368-08-6

2-Bromo-3-fluoroiodobenzene

Formula: C₆H₃BrFI

Purity: 95%

Color and Shape: faint lemon crystals

Molecular weight: 300.89g/mol

Ref: 54-PC51221

2-Bromo-3-fluoroiodobenzene

CAS: 851368-08-6

Formula: C₆H₃BrFI

Purity: 95%

Color and Shape: Solid, Low Melting Solid

Molecular weight: 300.897

Ref: 10-F043102