CAS 85137-09-3
:4-ethoxy-1,2-benzenediamine sulfate
Description:
4-Ethoxy-1,2-benzenediamine sulfate is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an ethoxy group and two amino groups at the 1 and 2 positions. This compound is typically a white to off-white solid and is soluble in water due to the presence of the sulfate group, which enhances its hydrophilicity. The amino groups can participate in various chemical reactions, making this compound potentially useful in organic synthesis and as an intermediate in the production of dyes or pharmaceuticals. Its sulfate component may also impart specific properties, such as increased stability and solubility in aqueous solutions. Safety data indicates that, like many amines, it may be irritating to the skin and eyes, and appropriate handling precautions should be taken. Overall, 4-ethoxy-1,2-benzenediamine sulfate is notable for its functional groups that allow for diverse chemical reactivity and applications in various fields.
Formula:C8H14N2O5S
InChI:InChI=1/C8H12N2O.H2O4S/c1-2-11-6-3-4-7(9)8(10)5-6;1-5(2,3)4/h3-5H,2,9-10H2,1H3;(H2,1,2,3,4)
InChI key:InChIKey=AOWLQOMCVRWFEA-UHFFFAOYSA-N
SMILES:O(CC)C1=CC(N)=C(N)C=C1.S(=O)(=O)(O)O
Synonyms:- 1,2-Benzenediamine, 4-ethoxy-, sulfate (1:1)
- sulfuric acid
- 4-Ethoxy-O-Phenylenediamine Sulfate
- 4-ethoxybenzene-1,2-diamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
