CAS 851373-13-2

Bixalomer

Description:

Bixalomer, identified by its CAS number 851373-13-2, is a synthetic polymeric compound primarily used in pharmaceutical applications, particularly as a drug delivery system. It is characterized by its ability to form stable complexes with various therapeutic agents, enhancing their solubility and bioavailability. Bixalomer exhibits a unique structure that allows for controlled release properties, making it suitable for sustained medication delivery. Additionally, it is known for its biocompatibility and low toxicity, which are essential for ensuring safety in medical applications. The substance is often explored in the context of treating conditions that require targeted therapy, as it can be engineered to release drugs in specific environments within the body. Its physicochemical properties, such as solubility and stability, can be influenced by factors like pH and ionic strength, which are critical for optimizing its performance in various formulations. Overall, Bixalomer represents a promising advancement in the field of drug formulation and delivery systems.

Formula: (C₁₆H₄₀N₆·C₃H₅ClO)x

InChI: InChI=1S/C16H40N6.C3H5ClO/c17-7-3-13-21(14-4-8-18)11-1-2-12-22(15-5-9-19)16-6-10-20;4-1-3-2-5-3/h1-20H2;3H,1-2H2

InChI key: InChIKey=UHTZABZWCSJMDY-UHFFFAOYSA-N

SMILES: N(CCCCN(CCCN)CCCN)(CCCN)CCCN.C(Cl)C1CO1

Synonyms:

• 1,4-Butanediamine, N,N,N′,N′-tetrakis(3-aminopropyl)-, polymer with (chloromethyl)oxirane
• Epichlorohydrin-N,N,N′,N′-tetrakis(3-aminopropyl)-1,4-butanediamine copolymer
• 1,4-Bis[bis(3-aminopropyl)amino]butane-epichlorohydrin copolymer
• EC 172A
• 1,4-Butanediamine, N,N,N′,N′-tetrakis(3-aminopropyl)-, polymer with 2-(chloromethyl)oxirane

Bixalomer

CAS: 851373-13-2

Ref: 4Z-B-254001