CAS 85138-49-4

2-[2,7-bis(2-carboxyethyl)-6-hydroxy-3-oxo-3H-xanthen-9-yl]benzene-1,4-dicarboxylic acid

Description:

2-[2,7-bis(2-carboxyethyl)-6-hydroxy-3-oxo-3H-xanthen-9-yl]benzene-1,4-dicarboxylic acid, with CAS number 85138-49-4, is a complex organic compound characterized by its xanthene core structure, which is modified with multiple carboxylic acid groups and a hydroxyl group. This compound typically exhibits strong fluorescence properties, making it useful in various applications such as fluorescent dyes and biological imaging. The presence of multiple carboxylic acid groups contributes to its solubility in polar solvents and enhances its reactivity, allowing for potential interactions with biomolecules. Additionally, the hydroxyl group can participate in hydrogen bonding, influencing its physical properties and reactivity. The compound's structural features suggest potential applications in fields such as biochemistry, materials science, and photonics. Its stability and behavior in different environments can be influenced by pH and solvent conditions, which are important considerations for its practical use. Overall, this compound represents a versatile structure with significant potential in scientific research and industrial applications.

Formula: C₂₇H₂₀O₁₁

InChI: InChI=1/C27H20O11/c28-19-10-21-17(7-12(19)2-5-23(30)31)25(16-9-14(26(34)35)1-4-15(16)27(36)37)18-8-13(3-6-24(32)33)20(29)11-22(18)38-21/h1,4,7-11,28H,2-3,5-6H2,(H,30,31)(H,32,33)(H,34,35)(H,36,37)

SMILES: c1cc(c(cc1C(=O)O)c1c2cc(CCC(=O)O)c(cc2oc2cc(=O)c(CCC(=O)O)cc12)O)C(=O)O

2',7'-bis(2-Carboxyethyl)-5(6)-carboxyfluorescein

CAS: 85138-49-4

Formula: C₅₄H₄₀O₂₂

Purity: 90%

Color and Shape: Solid

Molecular weight: 1040.8822

Ref: IN-DA004QSJ

BCECF

CAS: 85138-49-4

BCECF

Purity: ≥95%

Molecular weight: 520.44g/mol

Ref: 54-BUP21709

BCECF

CAS: 85138-49-4

BCECF is a pH-sensitive fluorescent dye and a cytosolic pH indicator. It can be used for detecting intracellular pH levels.

Formula: C₅₄H₄₀O₂₂

Purity: 98%

Color and Shape: Reddish-Brown Or Red Crystalline Powder

Molecular weight: 520.44

Ref: TM-T18922

2'',7''-bis(2-Carboxyethyl)-5(6)-carboxyfluorescein

CAS: 85138-49-4

Formula: C₂₇H₂₀O₁₁

Purity: ≥ 95.0%

Color and Shape: Yellow to red solid

Molecular weight: 520.5

Ref: 7W-GT2638

2',7'-Bis(2-carboxyethyl)-5(6)-carboxyfluorescein

CAS: 85138-49-4

2',7'-Bis(2-carboxyethyl)-5(6)-carboxyfluorescein (BCECF) is a fluorescent probe that is used to measure the intracellular concentration of Ca2+. BCECF binds to Ca2+ and transfers its energy to a fluorophore. This process results in an increase in fluorescence intensity proportional to the amount of Ca2+ present. The BCECF dye can be used for detecting mitochondrial membrane potential, as well as monitoring changes in cellular metabolism. It has been shown to be effective in mesenchymal cells, blood sampling, and internalization assays.

Formula: C₂₇H₂₀O₁₁

Purity: Min. 90 Area-%

Color and Shape: Powder

Molecular weight: 520.44 g/mol

Ref: 3D-FB15573