CAS 851386-31-7

2,3-Difluoropyridine-4-carboxylic acid

Description:

2,3-Difluoropyridine-4-carboxylic acid is a heterocyclic organic compound characterized by a pyridine ring substituted with two fluorine atoms and a carboxylic acid group. The presence of the fluorine atoms at the 2 and 3 positions of the pyridine ring significantly influences its chemical properties, including increased electronegativity and potential for hydrogen bonding. The carboxylic acid functional group at the 4-position contributes to its acidity and reactivity, making it a useful intermediate in organic synthesis. This compound is typically a colorless to pale yellow liquid or solid, depending on its form, and is soluble in polar solvents. Its unique structure allows for various applications in pharmaceuticals, agrochemicals, and materials science, particularly in the development of fluorinated compounds that exhibit enhanced biological activity or stability. Safety data should be consulted for handling, as fluorinated compounds can exhibit specific toxicity and environmental concerns.

Formula: C₆H₃F₂NO₂

InChI: InChI=1/C6H3F2NO2/c7-4-3(6(10)11)1-2-9-5(4)8/h1-2H,(H,10,11)

SMILES: c1cnc(c(c1C(=O)O)F)F

Synonyms:

• 2,3-Difluoroisonicotinic acid

2,3-Difluoroisonicotinic Acid

CAS: 851386-31-7

Formula: C₆H₃F₂NO₂

Purity: >98.0%(GC)(T)

Color and Shape: White to Orange to Green powder to crystal

Molecular weight: 159.09

Ref: 3B-D5131

2,3-Difluoroisonicotinic acid

CAS: 851386-31-7

Formula: C₆H₃F₂NO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 159.0903

Ref: IN-DA0032XS

2,3-Difluoroisonicotinic acid

CAS: 851386-31-7

2,3-Difluoroisonicotinic acid

Formula: C₆H₃F₂NO₂

Purity: ≥95%

Color and Shape: pale yellow crystals

Molecular weight: 159.09g/mol

Ref: 54-PC49549

2,3-Difluoroisonicotinic acid

CAS: 851386-31-7

Formula: C₆H₃F₂NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 159.092

Ref: 10-F076015