CymitQuimica logo

CAS 851386-33-9

:

5,6-difluoropyridine-3-carboxylic acid

Description:
5,6-Difluoropyridine-3-carboxylic acid is a heterocyclic organic compound characterized by a pyridine ring substituted with two fluorine atoms and a carboxylic acid group. The presence of the fluorine atoms at the 5 and 6 positions of the pyridine ring enhances the compound's reactivity and polarity, making it useful in various chemical applications, including pharmaceuticals and agrochemicals. The carboxylic acid functional group contributes to its acidity and solubility in polar solvents, facilitating its use in synthesis and as a building block in organic chemistry. This compound may exhibit biological activity due to its structural features, which can influence interactions with biological targets. Additionally, its unique combination of functional groups allows for potential derivatization, expanding its utility in synthetic pathways. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C6H3F2NO2
InChI:InChI=1/C6H3F2NO2/c7-4-1-3(6(10)11)2-9-5(4)8/h1-2H,(H,10,11)
InChI key:DGNBUWVYFMVMHG-UHFFFAOYSA-N
SMILES:c1c(cnc(c1F)F)C(=O)O
Synonyms:
  • 3-Pyridinecarboxylic Acid, 5,6-Difluoro-
  • 5,6-Difluoro Pyridine-3-Carboxylic Acid
  • 5,6-Difluoronicotinic acid
Found 5 products.