CAS 851386-34-0

2,3-Difluoro-4-iodo-pyridine

Description:

2,3-Difluoro-4-iodo-pyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with two fluorine atoms and one iodine atom. The presence of these halogen substituents significantly influences its chemical properties, including reactivity and polarity. The fluorine atoms, being highly electronegative, enhance the compound's electron-withdrawing characteristics, which can affect its behavior in nucleophilic substitution reactions. The iodine atom, while less electronegative than fluorine, introduces a larger atomic radius and can influence the compound's steric properties. This compound is typically used in organic synthesis and medicinal chemistry, where halogenated pyridines serve as important intermediates in the development of pharmaceuticals and agrochemicals. Additionally, the unique combination of fluorine and iodine can impart specific biological activities, making it a subject of interest in drug discovery. Its physical properties, such as boiling and melting points, solubility, and stability, are influenced by the arrangement and nature of the substituents on the pyridine ring.

Formula: C₅H₂F₂IN

InChI: InChI=1/C5H2F2IN/c6-4-3(8)1-2-9-5(4)7/h1-2H

SMILES: c1cnc(c(c1I)F)F

Synonyms:

• 2,3-Difluoro-4-iodopyridine
• Pyridine, 2,3-difluoro-4-iodo-

2,3-Difluoro-4-iodopyridine

CAS: 851386-34-0

Formula: C₅H₂F₂IN

Purity: 98%

Color and Shape: Solid

Molecular weight: 240.9774

Ref: IN-DA0038EA

2,3-Difluoro-4-iodopyridine

CAS: 851386-34-0

2,3-Difluoro-4-iodopyridine

Purity: 98%

Color and Shape: Solid

Molecular weight: 240.98g/mol

Ref: 54-PC201324

2,3-Difluoro-4-iodopyridine

CAS: 851386-34-0

Formula: C₅H₂F₂IN

Purity: 98%

Color and Shape: Solid

Molecular weight: 240.979

Ref: 10-F069643