CymitQuimica logo

CAS 851386-37-3

:

5,6-Difluoro-4-(trimethylsilyl)pyridine-2-carboxylic acid

Description:
5,6-Difluoro-4-(trimethylsilyl)pyridine-2-carboxylic acid is a chemical compound characterized by its pyridine ring, which is substituted at the 2-position with a carboxylic acid group and at the 4-position with a trimethylsilyl group. The presence of two fluorine atoms at the 5 and 6 positions enhances its reactivity and influences its electronic properties, making it useful in various chemical applications. The trimethylsilyl group contributes to the compound's stability and solubility in organic solvents, while also serving as a protective group in synthetic chemistry. This compound is typically utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Its unique structure and functional groups allow for selective reactivity, making it a valuable intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C9H11F2NO2Si
InChI:InChI=1/C9H11F2NO2Si/c1-15(2,3)6-4-5(9(13)14)12-8(11)7(6)10/h4H,1-3H3,(H,13,14)
SMILES:C[Si](C)(C)c1cc(C(=O)O)nc(c1F)F
Synonyms:
  • 2-Pyridinecarboxylic Acid, 5,6-Difluoro-4-(Trimethylsilyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.